C46H82O5Si3 — CID 10724041
(2S,5S,6R,12S,13S,14R)-1-[tert-butyl(dimethyl)silyl]oxy-2,6,12,14-tetramethyl-17-phenylmethoxy-5,13-bis(triethylsilyloxy)heptadeca-7,10-diyn-9-one (PubChem CID 10724041) has the molecular formula C46H82O5Si3 and a molecular weight of 799.41 g/mol. Its IUPAC name is (2S,5S,6R,12S,13S,14R)-1-[tert-butyl(dimethyl)silyl]oxy-2,6,12,14-tetramethyl-17-phenylmethoxy-5,13-bis(triethylsilyloxy)heptadeca-7,10-diyn-9-one.
| Compound Name | (2S,5S,6R,12S,13S,14R)-1-[tert-butyl(dimethyl)silyl]oxy-2,6,12,14-tetramethyl-17-phenylmethoxy-5,13-bis(triethylsilyloxy)heptadeca-7,10-diyn-9-one |
|---|---|
| PubChem CID | 10724041 |
| Molecular Formula | C46H82O5Si3 |
| Molecular Weight | 799.41 g/mol |
| Exact Mass | 798.55 |
| IUPAC Name | (2S,5S,6R,12S,13S,14R)-1-[tert-butyl(dimethyl)silyl]oxy-2,6,12,14-tetramethyl-17-phenylmethoxy-5,13-bis(triethylsilyloxy)heptadeca-7,10-diyn-9-one |
| SMILES | CC[Si](CC)(CC)O[C@@H]([C@H](C)CCCOCc1ccccc1)[C@@H](C)C#CC(=O)C#C[C@@H](C)[C@H](CC[C@H](C)CO[Si](C)(C)C(C)(C)C)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C46H82O5Si3/c1-16-53(17-2,18-3)50-44(34-29-38(7)36-49-52(14,15)46(11,12)13)39(8)30-32-43(47)33-31-41(10)45(51-54(19-4,20-5)21-6)40(9)26-25-35-48-37-42-27-23-22-24-28-42/h22-24,27-28,38-41,44-45H,16-21,25-26,29,34-37H2,1-15H3/t38-,39+,40+,41-,44-,45-/m0/s1 |
| InChIKey | IYLXVWBFDNQZSI-CVXPFTOQSA-N |
| XLogP | 12.69 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 799.41 |
| LogP ≤ 5 | 12.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_yne_A(1)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|