C16H24N2 — CID 10729011
(1R,2R,3S,4R,8S,9R,10S,11S)-1,11,14,14-tetramethyl-12,13-diazapentacyclo[9.2.1.02,10.03,9.04,8]tetradec-12-ene (PubChem CID 10729011) has the molecular formula C16H24N2 and a molecular weight of 244.38 g/mol. Its IUPAC name is (1R,2R,3S,4R,8S,9R,10S,11S)-1,11,14,14-tetramethyl-12,13-diazapentacyclo[9.2.1.02,10.03,9.04,8]tetradec-12-ene.
| Compound Name | (1R,2R,3S,4R,8S,9R,10S,11S)-1,11,14,14-tetramethyl-12,13-diazapentacyclo[9.2.1.02,10.03,9.04,8]tetradec-12-ene |
|---|---|
| PubChem CID | 10729011 |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | (1R,2R,3S,4R,8S,9R,10S,11S)-1,11,14,14-tetramethyl-12,13-diazapentacyclo[9.2.1.02,10.03,9.04,8]tetradec-12-ene |
| SMILES | CC1(C)[C@@]2(C)N=N[C@]1(C)[C@@H]1[C@H]3[C@@H]4CCC[C@@H]4[C@H]3[C@@H]12 |
| InChI | InChI=1S/C16H24N2/c1-14(2)15(3)12-10-8-6-5-7-9(8)11(10)13(12)16(14,4)18-17-15/h8-13H,5-7H2,1-4H3/t8-,9+,10+,11-,12-,13+,15-,16+ |
| InChIKey | WIULCNJYDRXWEY-GBOJTCOTSA-N |
| XLogP | 3.92 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cycloheptane_1', 'substructure': 'N/A'} |
|---|