C10H15N5OS2 — CID 107378656
N-(1,4-dithian-2-ylmethyl)-5-hydrazinylpyrazine-2-carboxamide (PubChem CID 107378656) has the molecular formula C10H15N5OS2 and a molecular weight of 285.40 g/mol. Its IUPAC name is N-(1,4-dithian-2-ylmethyl)-5-hydrazinylpyrazine-2-carboxamide.
| Compound Name | N-(1,4-dithian-2-ylmethyl)-5-hydrazinylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 107378656 |
| Molecular Formula | C10H15N5OS2 |
| Molecular Weight | 285.40 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | N-(1,4-dithian-2-ylmethyl)-5-hydrazinylpyrazine-2-carboxamide |
| SMILES | NNc1cnc(C(=O)NCC2CSCCS2)cn1 |
| InChI | InChI=1S/C10H15N5OS2/c11-15-9-5-12-8(4-13-9)10(16)14-3-7-6-17-1-2-18-7/h4-5,7H,1-3,6,11H2,(H,13,15)(H,14,16) |
| InChIKey | OJDDMAWHPJITSR-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.40 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|