C21H30O5Si — CID 10739168
(3aR,3bR,5R,9aR,9bS)-5-[tert-butyl(dimethyl)silyl]oxy-3a-methyl-3b,4,5,6,8,9,9a,9b-octahydro-as-indaceno[4,5-c]furan-1,3,7-trione (PubChem CID 10739168) has the molecular formula C21H30O5Si and a molecular weight of 390.55 g/mol. Its IUPAC name is (3aR,3bR,5R,9aR,9bS)-5-[tert-butyl(dimethyl)silyl]oxy-3a-methyl-3b,4,5,6,8,9,9a,9b-octahydro-as-indaceno[4,5-c]furan-1,3,7-trione.
| Compound Name | (3aR,3bR,5R,9aR,9bS)-5-[tert-butyl(dimethyl)silyl]oxy-3a-methyl-3b,4,5,6,8,9,9a,9b-octahydro-as-indaceno[4,5-c]furan-1,3,7-trione |
|---|---|
| PubChem CID | 10739168 |
| Molecular Formula | C21H30O5Si |
| Molecular Weight | 390.55 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | (3aR,3bR,5R,9aR,9bS)-5-[tert-butyl(dimethyl)silyl]oxy-3a-methyl-3b,4,5,6,8,9,9a,9b-octahydro-as-indaceno[4,5-c]furan-1,3,7-trione |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CC2=C3C(=O)CC[C@@H]3[C@@H]3C(=O)OC(=O)[C@]3(C)[C@@H]2C1 |
| InChI | InChI=1S/C21H30O5Si/c1-20(2,3)27(5,6)26-11-9-13-14(10-11)21(4)17(18(23)25-19(21)24)12-7-8-15(22)16(12)13/h11-12,14,17H,7-10H2,1-6H3/t11-,12-,14+,17+,21+/m0/s1 |
| InChIKey | WMVWMURSHQERBA-CTGDTLLCSA-N |
| XLogP | 3.78 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.55 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|