C33H37NO3 — CID 10743840
tert-butyl (E,2S)-7,7-dimethyl-6-oxo-2-[(9-phenylfluoren-9-yl)amino]oct-4-enoate (PubChem CID 10743840) has the molecular formula C33H37NO3 and a molecular weight of 495.66 g/mol. Its IUPAC name is tert-butyl (E,2S)-7,7-dimethyl-6-oxo-2-[(9-phenylfluoren-9-yl)amino]oct-4-enoate.
| Compound Name | tert-butyl (E,2S)-7,7-dimethyl-6-oxo-2-[(9-phenylfluoren-9-yl)amino]oct-4-enoate |
|---|---|
| PubChem CID | 10743840 |
| Molecular Formula | C33H37NO3 |
| Molecular Weight | 495.66 g/mol |
| Exact Mass | 495.28 |
| IUPAC Name | tert-butyl (E,2S)-7,7-dimethyl-6-oxo-2-[(9-phenylfluoren-9-yl)amino]oct-4-enoate |
| SMILES | CC(C)(C)OC(=O)[C@H](C/C=C/C(=O)C(C)(C)C)NC1(c2ccccc2)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C33H37NO3/c1-31(2,3)29(35)22-14-21-28(30(36)37-32(4,5)6)34-33(23-15-8-7-9-16-23)26-19-12-10-17-24(26)25-18-11-13-20-27(25)33/h7-20,22,28,34H,21H2,1-6H3/b22-14+/t28-/m0/s1 |
| InChIKey | CIWHRLPFMATAPC-IKIXNTAXSA-N |
| XLogP | 6.82 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.66 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|