C32H35NO3 — CID 10696136
tert-butyl (E,2S)-6-oxo-2-[(9-phenylfluoren-9-yl)amino]non-4-enoate (PubChem CID 10696136) has the molecular formula C32H35NO3 and a molecular weight of 481.64 g/mol. Its IUPAC name is tert-butyl (E,2S)-6-oxo-2-[(9-phenylfluoren-9-yl)amino]non-4-enoate.
| Compound Name | tert-butyl (E,2S)-6-oxo-2-[(9-phenylfluoren-9-yl)amino]non-4-enoate |
|---|---|
| PubChem CID | 10696136 |
| Molecular Formula | C32H35NO3 |
| Molecular Weight | 481.64 g/mol |
| Exact Mass | 481.26 |
| IUPAC Name | tert-butyl (E,2S)-6-oxo-2-[(9-phenylfluoren-9-yl)amino]non-4-enoate |
| SMILES | CCCC(=O)/C=C/C[C@H](NC1(c2ccccc2)c2ccccc2-c2ccccc21)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C32H35NO3/c1-5-14-24(34)17-13-22-29(30(35)36-31(2,3)4)33-32(23-15-7-6-8-16-23)27-20-11-9-18-25(27)26-19-10-12-21-28(26)32/h6-13,15-21,29,33H,5,14,22H2,1-4H3/b17-13+/t29-/m0/s1 |
| InChIKey | YLASSVVAFZEXQG-AELSSEKOSA-N |
| XLogP | 6.57 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.64 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|