C30H31NO3 — CID 10789861
tert-butyl (E,2S)-6-oxo-2-[(9-phenylfluoren-9-yl)amino]hept-4-enoate (PubChem CID 10789861) has the molecular formula C30H31NO3 and a molecular weight of 453.58 g/mol. Its IUPAC name is tert-butyl (E,2S)-6-oxo-2-[(9-phenylfluoren-9-yl)amino]hept-4-enoate.
| Compound Name | tert-butyl (E,2S)-6-oxo-2-[(9-phenylfluoren-9-yl)amino]hept-4-enoate |
|---|---|
| PubChem CID | 10789861 |
| Molecular Formula | C30H31NO3 |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | tert-butyl (E,2S)-6-oxo-2-[(9-phenylfluoren-9-yl)amino]hept-4-enoate |
| SMILES | CC(=O)/C=C/C[C@H](NC1(c2ccccc2)c2ccccc2-c2ccccc21)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H31NO3/c1-21(32)13-12-20-27(28(33)34-29(2,3)4)31-30(22-14-6-5-7-15-22)25-18-10-8-16-23(25)24-17-9-11-19-26(24)30/h5-19,27,31H,20H2,1-4H3/b13-12+/t27-/m0/s1 |
| InChIKey | INIGXKRKTVXTJP-QSRYBZNWSA-N |
| XLogP | 5.79 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|