C10H7Cl2NOS — CID 107663379
2,5-dichloro-4-(1,3-thiazol-2-ylmethyl)phenol (PubChem CID 107663379) has the molecular formula C10H7Cl2NOS and a molecular weight of 260.14 g/mol. Its IUPAC name is 2,5-dichloro-4-(1,3-thiazol-2-ylmethyl)phenol.
| Compound Name | 2,5-dichloro-4-(1,3-thiazol-2-ylmethyl)phenol |
|---|---|
| PubChem CID | 107663379 |
| Molecular Formula | C10H7Cl2NOS |
| Molecular Weight | 260.14 g/mol |
| Exact Mass | 258.96 |
| IUPAC Name | 2,5-dichloro-4-(1,3-thiazol-2-ylmethyl)phenol |
| SMILES | Oc1cc(Cl)c(Cc2nccs2)cc1Cl |
| InChI | InChI=1S/C10H7Cl2NOS/c11-7-5-9(14)8(12)3-6(7)4-10-13-1-2-15-10/h1-3,5,14H,4H2 |
| InChIKey | FJPPTQVUCPWWLH-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.14 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |