About 2,5-dichloro-4-(1,3-thiazol-2-ylmethyl)phenol
2,5-dichloro-4-(1,3-thiazol-2-ylmethyl)phenol (PubChem CID 107663379) has the molecular formula C10H7Cl2NOS
and a molecular weight of 260.14 g/mol. Its IUPAC name is 2,5-dichloro-4-(1,3-thiazol-2-ylmethyl)phenol.
Molecular Properties
| Compound Name | 2,5-dichloro-4-(1,3-thiazol-2-ylmethyl)phenol |
| PubChem CID | 107663379 |
| Molecular Formula | C10H7Cl2NOS |
| Molecular Weight | 260.14 g/mol |
| Exact Mass | 258.96 |
| IUPAC Name | 2,5-dichloro-4-(1,3-thiazol-2-ylmethyl)phenol |
| SMILES | Oc1cc(Cl)c(Cc2nccs2)cc1Cl |
| InChI | InChI=1S/C10H7Cl2NOS/c11-7-5-9(14)8(12)3-6(7)4-10-13-1-2-15-10/h1-3,5,14H,4H2 |
| InChIKey | FJPPTQVUCPWWLH-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.14 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,5-dichloro-4-(1,3-thiazol-2-ylmethyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dichloro-4-(1,3-thiazol-2-ylmethyl)phenol?
The IUPAC name of 2,5-dichloro-4-(1,3-thiazol-2-ylmethyl)phenol (CID 107663379) is 2,5-dichloro-4-(1,3-thiazol-2-ylmethyl)phenol.
What is the SMILES notation for 2,5-dichloro-4-(1,3-thiazol-2-ylmethyl)phenol?
The canonical SMILES for 2,5-dichloro-4-(1,3-thiazol-2-ylmethyl)phenol is Oc1cc(Cl)c(Cc2nccs2)cc1Cl.
What is the InChIKey of 2,5-dichloro-4-(1,3-thiazol-2-ylmethyl)phenol?
The InChIKey is FJPPTQVUCPWWLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7Cl2NOS/c11-7-5-9(14)8(12)3-6(7)4-10-13-1-2-15-10/h1-3,5,14H,4H2.
What are the key properties of 2,5-dichloro-4-(1,3-thiazol-2-ylmethyl)phenol?
2,5-dichloro-4-(1,3-thiazol-2-ylmethyl)phenol has a molecular weight of 260.14 g/mol, XLogP of 3.75, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dichloro-4-(1,3-thiazol-2-ylmethyl)phenol is sourced from PubChem (CID 107663379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).