C26H35NO5SSi — CID 10767758
(4Z)-2-(benzenesulfonyl)-7-butyl-6-propan-2-yloxy-4-(trimethylsilylmethylidene)-1,3-dihydroisoquinoline-5,8-dione (PubChem CID 10767758) has the molecular formula C26H35NO5SSi and a molecular weight of 501.72 g/mol. Its IUPAC name is (4Z)-2-(benzenesulfonyl)-7-butyl-6-propan-2-yloxy-4-(trimethylsilylmethylidene)-1,3-dihydroisoquinoline-5,8-dione.
| Compound Name | (4Z)-2-(benzenesulfonyl)-7-butyl-6-propan-2-yloxy-4-(trimethylsilylmethylidene)-1,3-dihydroisoquinoline-5,8-dione |
|---|---|
| PubChem CID | 10767758 |
| Molecular Formula | C26H35NO5SSi |
| Molecular Weight | 501.72 g/mol |
| Exact Mass | 501.20 |
| IUPAC Name | (4Z)-2-(benzenesulfonyl)-7-butyl-6-propan-2-yloxy-4-(trimethylsilylmethylidene)-1,3-dihydroisoquinoline-5,8-dione |
| SMILES | CCCCC1=C(OC(C)C)C(=O)C2=C(CN(S(=O)(=O)c3ccccc3)C/C2=C\[Si](C)(C)C)C1=O |
| InChI | InChI=1S/C26H35NO5SSi/c1-7-8-14-21-24(28)22-16-27(33(30,31)20-12-10-9-11-13-20)15-19(17-34(4,5)6)23(22)25(29)26(21)32-18(2)3/h9-13,17-18H,7-8,14-16H2,1-6H3/b19-17+ |
| InChIKey | BCOUVDYIYCAAEL-HTXNQAPBSA-N |
| XLogP | 4.81 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.72 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|