C14H15N3O — CID 10776484
3-[2-(4-methoxyphenyl)ethynyl]-1,5-dimethylpyrazol-4-amine (PubChem CID 10776484) has the molecular formula C14H15N3O and a molecular weight of 241.29 g/mol. Its IUPAC name is 3-[2-(4-methoxyphenyl)ethynyl]-1,5-dimethylpyrazol-4-amine.
| Compound Name | 3-[2-(4-methoxyphenyl)ethynyl]-1,5-dimethylpyrazol-4-amine |
|---|---|
| PubChem CID | 10776484 |
| Molecular Formula | C14H15N3O |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 3-[2-(4-methoxyphenyl)ethynyl]-1,5-dimethylpyrazol-4-amine |
| SMILES | COc1ccc(C#Cc2nn(C)c(C)c2N)cc1 |
| InChI | InChI=1S/C14H15N3O/c1-10-14(15)13(16-17(10)2)9-6-11-4-7-12(18-3)8-5-11/h4-5,7-8H,15H2,1-3H3 |
| InChIKey | PZWWCSQTZQGQNW-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|