C14H14N2O — CID 122368627
5-[2-(4-methoxyphenyl)ethynyl]-1,2-dimethylimidazole (PubChem CID 122368627) has the molecular formula C14H14N2O and a molecular weight of 226.28 g/mol. Its IUPAC name is 5-[2-(4-methoxyphenyl)ethynyl]-1,2-dimethylimidazole.
| Compound Name | 5-[2-(4-methoxyphenyl)ethynyl]-1,2-dimethylimidazole |
|---|---|
| PubChem CID | 122368627 |
| Molecular Formula | C14H14N2O |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 5-[2-(4-methoxyphenyl)ethynyl]-1,2-dimethylimidazole |
| SMILES | COc1ccc(C#Cc2cnc(C)n2C)cc1 |
| InChI | InChI=1S/C14H14N2O/c1-11-15-10-13(16(11)2)7-4-12-5-8-14(17-3)9-6-12/h5-6,8-10H,1-3H3 |
| InChIKey | HJLFSOPZEGXIOE-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|