C19H34O7Si — CID 10787313
(1S,3R,7S,10R)-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-5,5,12,12-tetramethyl-4,6,8,11,13-pentaoxatricyclo[8.3.0.03,7]tridecan-9-one (PubChem CID 10787313) has the molecular formula C19H34O7Si and a molecular weight of 402.56 g/mol. Its IUPAC name is (1S,3R,7S,10R)-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-5,5,12,12-tetramethyl-4,6,8,11,13-pentaoxatricyclo[8.3.0.03,7]tridecan-9-one.
| Compound Name | (1S,3R,7S,10R)-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-5,5,12,12-tetramethyl-4,6,8,11,13-pentaoxatricyclo[8.3.0.03,7]tridecan-9-one |
|---|---|
| PubChem CID | 10787313 |
| Molecular Formula | C19H34O7Si |
| Molecular Weight | 402.56 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | (1S,3R,7S,10R)-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-5,5,12,12-tetramethyl-4,6,8,11,13-pentaoxatricyclo[8.3.0.03,7]tridecan-9-one |
| SMILES | CC1(C)O[C@H]2OC(=O)[C@@H]3OC(C)(C)O[C@]3(CO[Si](C)(C)C(C)(C)C)C[C@H]2O1 |
| InChI | InChI=1S/C19H34O7Si/c1-16(2,3)27(8,9)21-11-19-10-12-15(25-17(4,5)23-12)22-14(20)13(19)24-18(6,7)26-19/h12-13,15H,10-11H2,1-9H3/t12-,13+,15-,19+/m1/s1 |
| InChIKey | ZNVQJXYIWNCIGE-IZSNYMMISA-N |
| XLogP | 3.32 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.56 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|