C21H46O2Si2 — CID 10810218
trimethyl-[(E,3R,4R,6R,7R,8R)-2,4,6,8-tetramethyl-7-trimethylsilyloxyundec-9-en-3-yl]oxysilane (PubChem CID 10810218) has the molecular formula C21H46O2Si2 and a molecular weight of 386.77 g/mol. Its IUPAC name is trimethyl-[(E,3R,4R,6R,7R,8R)-2,4,6,8-tetramethyl-7-trimethylsilyloxyundec-9-en-3-yl]oxysilane.
| Compound Name | trimethyl-[(E,3R,4R,6R,7R,8R)-2,4,6,8-tetramethyl-7-trimethylsilyloxyundec-9-en-3-yl]oxysilane |
|---|---|
| PubChem CID | 10810218 |
| Molecular Formula | C21H46O2Si2 |
| Molecular Weight | 386.77 g/mol |
| Exact Mass | 386.30 |
| IUPAC Name | trimethyl-[(E,3R,4R,6R,7R,8R)-2,4,6,8-tetramethyl-7-trimethylsilyloxyundec-9-en-3-yl]oxysilane |
| SMILES | C/C=C/[C@@H](C)[C@H](O[Si](C)(C)C)[C@H](C)C[C@@H](C)[C@H](O[Si](C)(C)C)C(C)C |
| InChI | InChI=1S/C21H46O2Si2/c1-13-14-17(4)21(23-25(10,11)12)19(6)15-18(5)20(16(2)3)22-24(7,8)9/h13-14,16-21H,15H2,1-12H3/b14-13+/t17-,18-,19-,20-,21+/m1/s1 |
| InChIKey | PFXMPCPCQXZWIQ-MVLGCVPUSA-N |
| XLogP | 6.96 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.77 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|