C25H31NO7 — CID 10813723
methyl (4R,5R)-5-[benzyl-(2,2-dimethoxy-1-phenylethyl)carbamoyl]-2,2-dimethyl-1,3-dioxolane-4-carboxylate (PubChem CID 10813723) has the molecular formula C25H31NO7 and a molecular weight of 457.52 g/mol. Its IUPAC name is methyl (4R,5R)-5-[benzyl-(2,2-dimethoxy-1-phenylethyl)carbamoyl]-2,2-dimethyl-1,3-dioxolane-4-carboxylate.
| Compound Name | methyl (4R,5R)-5-[benzyl-(2,2-dimethoxy-1-phenylethyl)carbamoyl]-2,2-dimethyl-1,3-dioxolane-4-carboxylate |
|---|---|
| PubChem CID | 10813723 |
| Molecular Formula | C25H31NO7 |
| Molecular Weight | 457.52 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | methyl (4R,5R)-5-[benzyl-(2,2-dimethoxy-1-phenylethyl)carbamoyl]-2,2-dimethyl-1,3-dioxolane-4-carboxylate |
| SMILES | COC(=O)[C@@H]1OC(C)(C)O[C@H]1C(=O)N(Cc1ccccc1)C(c1ccccc1)C(OC)OC |
| InChI | InChI=1S/C25H31NO7/c1-25(2)32-20(21(33-25)23(28)29-3)22(27)26(16-17-12-8-6-9-13-17)19(24(30-4)31-5)18-14-10-7-11-15-18/h6-15,19-21,24H,16H2,1-5H3/t19?,20-,21-/m1/s1 |
| InChIKey | TUMDDDFNRAKPNZ-RWLBOTFQSA-N |
| XLogP | 3.07 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.52 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|