C25H24N2O7S2 — CID 10816000
[(3R,4S,5R,6S)-4,5-diacetyloxy-6-(3-phenyl-4-sulfanylidenequinazolin-2-yl)sulfanyloxan-3-yl] acetate (PubChem CID 10816000) has the molecular formula C25H24N2O7S2 and a molecular weight of 528.61 g/mol. Its IUPAC name is [(3R,4S,5R,6S)-4,5-diacetyloxy-6-(3-phenyl-4-sulfanylidenequinazolin-2-yl)sulfanyloxan-3-yl] acetate.
| Compound Name | [(3R,4S,5R,6S)-4,5-diacetyloxy-6-(3-phenyl-4-sulfanylidenequinazolin-2-yl)sulfanyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 10816000 |
| Molecular Formula | C25H24N2O7S2 |
| Molecular Weight | 528.61 g/mol |
| Exact Mass | 528.10 |
| IUPAC Name | [(3R,4S,5R,6S)-4,5-diacetyloxy-6-(3-phenyl-4-sulfanylidenequinazolin-2-yl)sulfanyloxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](OC(C)=O)[C@H](Sc2nc3ccccc3c(=S)n2-c2ccccc2)OC[C@H]1OC(C)=O |
| InChI | InChI=1S/C25H24N2O7S2/c1-14(28)32-20-13-31-24(22(34-16(3)30)21(20)33-15(2)29)36-25-26-19-12-8-7-11-18(19)23(35)27(25)17-9-5-4-6-10-17/h4-12,20-22,24H,13H2,1-3H3/t20-,21+,22-,24+/m1/s1 |
| InChIKey | UIXHCWSHXXDLKB-GBAAUQCPSA-N |
| XLogP | 4.00 |
| TPSA | 105.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.61 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|