C45H32N4 — CID 10818368
24-methyl-2,7,12,17-tetraphenyl-4,21,22,23-tetrazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1,3,5,7,9,11,13(22),14,16,18(21),19-undecaene (PubChem CID 10818368) has the molecular formula C45H32N4 and a molecular weight of 628.78 g/mol. Its IUPAC name is 24-methyl-2,7,12,17-tetraphenyl-4,21,22,23-tetrazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1,3,5,7,9,11,13(22),14,16,18(21),19-undecaene.
| Compound Name | 24-methyl-2,7,12,17-tetraphenyl-4,21,22,23-tetrazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1,3,5,7,9,11,13(22),14,16,18(21),19-undecaene |
|---|---|
| PubChem CID | 10818368 |
| Molecular Formula | C45H32N4 |
| Molecular Weight | 628.78 g/mol |
| Exact Mass | 628.26 |
| IUPAC Name | 24-methyl-2,7,12,17-tetraphenyl-4,21,22,23-tetrazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1,3,5,7,9,11,13(22),14,16,18(21),19-undecaene |
| SMILES | CC1C2=CN=C1/C(c1ccccc1)=C1/C=CC(=N1)/C(c1ccccc1)=C1/C=CC(=N1)/C(c1ccccc1)=c1/cc/c([nH]1)=C/2c1ccccc1 |
| InChI | InChI=1S/C45H32N4/c1-29-34-28-46-45(29)44(33-20-12-5-13-21-33)40-27-26-39(49-40)43(32-18-10-4-11-19-32)38-25-24-37(48-38)42(31-16-8-3-9-17-31)36-23-22-35(47-36)41(34)30-14-6-2-7-15-30/h2-29,47H,1H3/b41-34-,41-35-,42-36-,42-37-,43-38-,43-39-,44-40-,45-44+ |
| InChIKey | OPJPEQWIYQKVPA-TZHPXGTFSA-N |
| XLogP | 8.25 |
| TPSA | 52.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.78 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |