C24H38O4Si — CID 10835839
4-methoxy-3-(triethylsilyloxymethyl)-6-[(1E,7E,9E)-undeca-1,7,9-trienyl]pyran-2-one (PubChem CID 10835839) has the molecular formula C24H38O4Si and a molecular weight of 418.65 g/mol. Its IUPAC name is 4-methoxy-3-(triethylsilyloxymethyl)-6-[(1E,7E,9E)-undeca-1,7,9-trienyl]pyran-2-one.
| Compound Name | 4-methoxy-3-(triethylsilyloxymethyl)-6-[(1E,7E,9E)-undeca-1,7,9-trienyl]pyran-2-one |
|---|---|
| PubChem CID | 10835839 |
| Molecular Formula | C24H38O4Si |
| Molecular Weight | 418.65 g/mol |
| Exact Mass | 418.25 |
| IUPAC Name | 4-methoxy-3-(triethylsilyloxymethyl)-6-[(1E,7E,9E)-undeca-1,7,9-trienyl]pyran-2-one |
| SMILES | C/C=C/C=C/CCCC/C=C/c1cc(OC)c(CO[Si](CC)(CC)CC)c(=O)o1 |
| InChI | InChI=1S/C24H38O4Si/c1-6-10-11-12-13-14-15-16-17-18-21-19-23(26-5)22(24(25)28-21)20-27-29(7-2,8-3)9-4/h6,10-12,17-19H,7-9,13-16,20H2,1-5H3/b10-6+,12-11+,18-17+ |
| InChIKey | BYOOMZPTWZVIOX-AOGLCUKNSA-N |
| XLogP | 6.88 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.65 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|