C24H24N2O5S — CID 10837344
prop-2-enyl 2-oxo-4-phenyl-1-prop-2-enyl-6-(4-sulfamoylphenyl)-3,4-dihydropyridine-3-carboxylate (PubChem CID 10837344) has the molecular formula C24H24N2O5S and a molecular weight of 452.53 g/mol. Its IUPAC name is prop-2-enyl 2-oxo-4-phenyl-1-prop-2-enyl-6-(4-sulfamoylphenyl)-3,4-dihydropyridine-3-carboxylate.
| Compound Name | prop-2-enyl 2-oxo-4-phenyl-1-prop-2-enyl-6-(4-sulfamoylphenyl)-3,4-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 10837344 |
| Molecular Formula | C24H24N2O5S |
| Molecular Weight | 452.53 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | prop-2-enyl 2-oxo-4-phenyl-1-prop-2-enyl-6-(4-sulfamoylphenyl)-3,4-dihydropyridine-3-carboxylate |
| SMILES | C=CCOC(=O)C1C(=O)N(CC=C)C(c2ccc(S(N)(=O)=O)cc2)=CC1c1ccccc1 |
| InChI | InChI=1S/C24H24N2O5S/c1-3-14-26-21(18-10-12-19(13-11-18)32(25,29)30)16-20(17-8-6-5-7-9-17)22(23(26)27)24(28)31-15-4-2/h3-13,16,20,22H,1-2,14-15H2,(H2,25,29,30) |
| InChIKey | QNWHLHSUYGHKDV-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.53 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|