C19H19NO — CID 10850160
(12-methyl-12-azatetracyclo[9.7.0.03,8.013,18]octadeca-1(11),3,5,7,13,15,17-heptaen-2-yl)methanol (PubChem CID 10850160) has the molecular formula C19H19NO and a molecular weight of 277.37 g/mol. Its IUPAC name is (12-methyl-12-azatetracyclo[9.7.0.03,8.013,18]octadeca-1(11),3,5,7,13,15,17-heptaen-2-yl)methanol.
| Compound Name | (12-methyl-12-azatetracyclo[9.7.0.03,8.013,18]octadeca-1(11),3,5,7,13,15,17-heptaen-2-yl)methanol |
|---|---|
| PubChem CID | 10850160 |
| Molecular Formula | C19H19NO |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | (12-methyl-12-azatetracyclo[9.7.0.03,8.013,18]octadeca-1(11),3,5,7,13,15,17-heptaen-2-yl)methanol |
| SMILES | Cn1c2c(c3ccccc31)C(CO)c1ccccc1CC2 |
| InChI | InChI=1S/C19H19NO/c1-20-17-9-5-4-8-15(17)19-16(12-21)14-7-3-2-6-13(14)10-11-18(19)20/h2-9,16,21H,10-12H2,1H3 |
| InChIKey | SROKLWUSFATQMA-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|