C12H22N4O4S — CID 108527125
N'-(1,1-dioxothiolan-3-yl)-N'-methyl-N-(4-methylpiperazin-1-yl)oxamide (PubChem CID 108527125) has the molecular formula C12H22N4O4S and a molecular weight of 318.40 g/mol. Its IUPAC name is N'-(1,1-dioxothiolan-3-yl)-N'-methyl-N-(4-methylpiperazin-1-yl)oxamide.
| Compound Name | N'-(1,1-dioxothiolan-3-yl)-N'-methyl-N-(4-methylpiperazin-1-yl)oxamide |
|---|---|
| PubChem CID | 108527125 |
| Molecular Formula | C12H22N4O4S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | N'-(1,1-dioxothiolan-3-yl)-N'-methyl-N-(4-methylpiperazin-1-yl)oxamide |
| SMILES | CN1CCN(NC(=O)C(=O)N(C)C2CCS(=O)(=O)C2)CC1 |
| InChI | InChI=1S/C12H22N4O4S/c1-14-4-6-16(7-5-14)13-11(17)12(18)15(2)10-3-8-21(19,20)9-10/h10H,3-9H2,1-2H3,(H,13,17) |
| InChIKey | QOHBYISNYGUGCH-UHFFFAOYSA-N |
| XLogP | -2.09 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|