C16H20O8S — CID 10861636
[(2R)-2-[(3aS,6R,6aS)-2,2-dimethyl-4-oxo-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]-2-hydroxyethyl] 4-methylbenzenesulfonate (PubChem CID 10861636) has the molecular formula C16H20O8S and a molecular weight of 372.40 g/mol. Its IUPAC name is [(2R)-2-[(3aS,6R,6aS)-2,2-dimethyl-4-oxo-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]-2-hydroxyethyl] 4-methylbenzenesulfonate.
| Compound Name | [(2R)-2-[(3aS,6R,6aS)-2,2-dimethyl-4-oxo-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]-2-hydroxyethyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10861636 |
| Molecular Formula | C16H20O8S |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | [(2R)-2-[(3aS,6R,6aS)-2,2-dimethyl-4-oxo-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]-2-hydroxyethyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@H](O)[C@H]2OC(=O)[C@H]3OC(C)(C)O[C@@H]23)cc1 |
| InChI | InChI=1S/C16H20O8S/c1-9-4-6-10(7-5-9)25(19,20)21-8-11(17)12-13-14(15(18)22-12)24-16(2,3)23-13/h4-7,11-14,17H,8H2,1-3H3/t11-,12-,13+,14+/m1/s1 |
| InChIKey | DWNLOYDERJTOJE-MQYQWHSLSA-N |
| XLogP | 0.51 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|