C27H50O2Si2 — CID 10863533
[(6R)-6-[(3aR,4S,7aS)-7a-methyl-4-trimethylsilyloxy-3,3a,4,5,6,7-hexahydroinden-1-yl]-2-methylhept-3-yn-2-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 10863533) has the molecular formula C27H50O2Si2 and a molecular weight of 462.87 g/mol. Its IUPAC name is [(6R)-6-[(3aR,4S,7aS)-7a-methyl-4-trimethylsilyloxy-3,3a,4,5,6,7-hexahydroinden-1-yl]-2-methylhept-3-yn-2-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(6R)-6-[(3aR,4S,7aS)-7a-methyl-4-trimethylsilyloxy-3,3a,4,5,6,7-hexahydroinden-1-yl]-2-methylhept-3-yn-2-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10863533 |
| Molecular Formula | C27H50O2Si2 |
| Molecular Weight | 462.87 g/mol |
| Exact Mass | 462.33 |
| IUPAC Name | [(6R)-6-[(3aR,4S,7aS)-7a-methyl-4-trimethylsilyloxy-3,3a,4,5,6,7-hexahydroinden-1-yl]-2-methylhept-3-yn-2-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C[C@H](CC#CC(C)(C)O[Si](C)(C)C(C)(C)C)C1=CC[C@H]2[C@@H](O[Si](C)(C)C)CCC[C@]12C |
| InChI | InChI=1S/C27H50O2Si2/c1-21(15-13-19-26(5,6)29-31(11,12)25(2,3)4)22-17-18-23-24(28-30(8,9)10)16-14-20-27(22,23)7/h17,21,23-24H,14-16,18,20H2,1-12H3/t21-,23+,24+,27-/m1/s1 |
| InChIKey | PVWUUQSHDHJMED-VHENIMGFSA-N |
| XLogP | 8.17 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.87 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|