C26H48F2O2Si — CID 10742557
(7R)-7-[(3aR,4S,7aS)-7a-methyl-4-triethylsilyloxy-3,3a,4,5,6,7-hexahydroinden-1-yl]-3-ethyl-4,4-difluorooctan-3-ol (PubChem CID 10742557) has the molecular formula C26H48F2O2Si and a molecular weight of 458.75 g/mol. Its IUPAC name is (7R)-7-[(3aR,4S,7aS)-7a-methyl-4-triethylsilyloxy-3,3a,4,5,6,7-hexahydroinden-1-yl]-3-ethyl-4,4-difluorooctan-3-ol.
| Compound Name | (7R)-7-[(3aR,4S,7aS)-7a-methyl-4-triethylsilyloxy-3,3a,4,5,6,7-hexahydroinden-1-yl]-3-ethyl-4,4-difluorooctan-3-ol |
|---|---|
| PubChem CID | 10742557 |
| Molecular Formula | C26H48F2O2Si |
| Molecular Weight | 458.75 g/mol |
| Exact Mass | 458.34 |
| IUPAC Name | (7R)-7-[(3aR,4S,7aS)-7a-methyl-4-triethylsilyloxy-3,3a,4,5,6,7-hexahydroinden-1-yl]-3-ethyl-4,4-difluorooctan-3-ol |
| SMILES | CCC(O)(CC)C(F)(F)CC[C@@H](C)C1=CC[C@H]2[C@@H](O[Si](CC)(CC)CC)CCC[C@]12C |
| InChI | InChI=1S/C26H48F2O2Si/c1-8-25(29,9-2)26(27,28)19-17-20(6)21-15-16-22-23(14-13-18-24(21,22)7)30-31(10-3,11-4)12-5/h15,20,22-23,29H,8-14,16-19H2,1-7H3/t20-,22+,23+,24-/m1/s1 |
| InChIKey | QHOJANLJQMEJSA-AYVPJYCDSA-N |
| XLogP | 8.12 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.75 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|