C17H23N5OS — CID 108831918
(Z)-3-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)amino]-2-(4-methylpiperidine-1-carbonyl)prop-2-enenitrile (PubChem CID 108831918) has the molecular formula C17H23N5OS and a molecular weight of 345.47 g/mol. Its IUPAC name is (Z)-3-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)amino]-2-(4-methylpiperidine-1-carbonyl)prop-2-enenitrile.
| Compound Name | (Z)-3-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)amino]-2-(4-methylpiperidine-1-carbonyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 108831918 |
| Molecular Formula | C17H23N5OS |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | (Z)-3-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)amino]-2-(4-methylpiperidine-1-carbonyl)prop-2-enenitrile |
| SMILES | CC1CCN(C(=O)/C(C#N)=C\Nc2nc3c(s2)CN(C)CC3)CC1 |
| InChI | InChI=1S/C17H23N5OS/c1-12-3-7-22(8-4-12)16(23)13(9-18)10-19-17-20-14-5-6-21(2)11-15(14)24-17/h10,12H,3-8,11H2,1-2H3,(H,19,20)/b13-10- |
| InChIKey | BUTNSJKJBUQIHF-RAXLEYEMSA-N |
| XLogP | 2.21 |
| TPSA | 72.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|