C18H16F3N5OS — CID 108822989
(Z)-2-cyano-3-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)amino]-N-[2-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 108822989) has the molecular formula C18H16F3N5OS and a molecular weight of 407.42 g/mol. Its IUPAC name is (Z)-2-cyano-3-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)amino]-N-[2-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)amino]-N-[2-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 108822989 |
| Molecular Formula | C18H16F3N5OS |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | (Z)-2-cyano-3-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)amino]-N-[2-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | CN1CCc2nc(N/C=C(/C#N)C(=O)Nc3ccccc3C(F)(F)F)sc2C1 |
| InChI | InChI=1S/C18H16F3N5OS/c1-26-7-6-14-15(10-26)28-17(25-14)23-9-11(8-22)16(27)24-13-5-3-2-4-12(13)18(19,20)21/h2-5,9H,6-7,10H2,1H3,(H,23,25)(H,24,27)/b11-9- |
| InChIKey | CKTGLDJAIKCTQX-LUAWRHEFSA-N |
| XLogP | 3.61 |
| TPSA | 81.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|