C17H16ClN5OS — CID 108824479
(Z)-N-(2-chlorophenyl)-2-cyano-3-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)amino]prop-2-enamide (PubChem CID 108824479) has the molecular formula C17H16ClN5OS and a molecular weight of 373.87 g/mol. Its IUPAC name is (Z)-N-(2-chlorophenyl)-2-cyano-3-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)amino]prop-2-enamide.
| Compound Name | (Z)-N-(2-chlorophenyl)-2-cyano-3-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)amino]prop-2-enamide |
|---|---|
| PubChem CID | 108824479 |
| Molecular Formula | C17H16ClN5OS |
| Molecular Weight | 373.87 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | (Z)-N-(2-chlorophenyl)-2-cyano-3-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)amino]prop-2-enamide |
| SMILES | CN1CCc2nc(N/C=C(/C#N)C(=O)Nc3ccccc3Cl)sc2C1 |
| InChI | InChI=1S/C17H16ClN5OS/c1-23-7-6-14-15(10-23)25-17(22-14)20-9-11(8-19)16(24)21-13-5-3-2-4-12(13)18/h2-5,9H,6-7,10H2,1H3,(H,20,22)(H,21,24)/b11-9- |
| InChIKey | JBUZDYLINJFKFP-LUAWRHEFSA-N |
| XLogP | 3.24 |
| TPSA | 81.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.87 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|