C18H18ClN5OS — CID 108850116
(Z)-N-(5-chloro-2-methylphenyl)-2-cyano-3-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)amino]prop-2-enamide (PubChem CID 108850116) has the molecular formula C18H18ClN5OS and a molecular weight of 387.90 g/mol. Its IUPAC name is (Z)-N-(5-chloro-2-methylphenyl)-2-cyano-3-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)amino]prop-2-enamide.
| Compound Name | (Z)-N-(5-chloro-2-methylphenyl)-2-cyano-3-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)amino]prop-2-enamide |
|---|---|
| PubChem CID | 108850116 |
| Molecular Formula | C18H18ClN5OS |
| Molecular Weight | 387.90 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | (Z)-N-(5-chloro-2-methylphenyl)-2-cyano-3-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)amino]prop-2-enamide |
| SMILES | Cc1ccc(Cl)cc1NC(=O)/C(C#N)=C\Nc1nc2c(s1)CN(C)CC2 |
| InChI | InChI=1S/C18H18ClN5OS/c1-11-3-4-13(19)7-15(11)22-17(25)12(8-20)9-21-18-23-14-5-6-24(2)10-16(14)26-18/h3-4,7,9H,5-6,10H2,1-2H3,(H,21,23)(H,22,25)/b12-9- |
| InChIKey | OENYGNLAFJFILU-XFXZXTDPSA-N |
| XLogP | 3.55 |
| TPSA | 81.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.90 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|