C18H26N6OS — CID 108838608
(Z)-2-cyano-N-methyl-3-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)amino]-N-(1-methylpiperidin-4-yl)prop-2-enamide (PubChem CID 108838608) has the molecular formula C18H26N6OS and a molecular weight of 374.51 g/mol. Its IUPAC name is (Z)-2-cyano-N-methyl-3-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)amino]-N-(1-methylpiperidin-4-yl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-methyl-3-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)amino]-N-(1-methylpiperidin-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 108838608 |
| Molecular Formula | C18H26N6OS |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | (Z)-2-cyano-N-methyl-3-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)amino]-N-(1-methylpiperidin-4-yl)prop-2-enamide |
| SMILES | CN1CCC(N(C)C(=O)/C(C#N)=C\Nc2nc3c(s2)CN(C)CC3)CC1 |
| InChI | InChI=1S/C18H26N6OS/c1-22-7-4-14(5-8-22)24(3)17(25)13(10-19)11-20-18-21-15-6-9-23(2)12-16(15)26-18/h11,14H,4-9,12H2,1-3H3,(H,20,21)/b13-11- |
| InChIKey | RUFRDWLCVSKFDO-QBFSEMIESA-N |
| XLogP | 1.50 |
| TPSA | 75.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|