C13H16ClN5OS — CID 108854582
(Z)-N-(2-chloroethyl)-2-cyano-3-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)amino]prop-2-enamide (PubChem CID 108854582) has the molecular formula C13H16ClN5OS and a molecular weight of 325.83 g/mol. Its IUPAC name is (Z)-N-(2-chloroethyl)-2-cyano-3-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)amino]prop-2-enamide.
| Compound Name | (Z)-N-(2-chloroethyl)-2-cyano-3-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)amino]prop-2-enamide |
|---|---|
| PubChem CID | 108854582 |
| Molecular Formula | C13H16ClN5OS |
| Molecular Weight | 325.83 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | (Z)-N-(2-chloroethyl)-2-cyano-3-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)amino]prop-2-enamide |
| SMILES | CN1CCc2nc(N/C=C(/C#N)C(=O)NCCCl)sc2C1 |
| InChI | InChI=1S/C13H16ClN5OS/c1-19-5-2-10-11(8-19)21-13(18-10)17-7-9(6-15)12(20)16-4-3-14/h7H,2-5,8H2,1H3,(H,16,20)(H,17,18)/b9-7- |
| InChIKey | SFJJVJADXLEKNX-CLFYSBASSA-N |
| XLogP | 1.31 |
| TPSA | 81.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.83 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|