C21H19N5O2S — CID 108843033
(Z)-2-cyano-N-(5-hydroxynaphthalen-1-yl)-3-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)amino]prop-2-enamide (PubChem CID 108843033) has the molecular formula C21H19N5O2S and a molecular weight of 405.48 g/mol. Its IUPAC name is (Z)-2-cyano-N-(5-hydroxynaphthalen-1-yl)-3-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)amino]prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(5-hydroxynaphthalen-1-yl)-3-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)amino]prop-2-enamide |
|---|---|
| PubChem CID | 108843033 |
| Molecular Formula | C21H19N5O2S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | (Z)-2-cyano-N-(5-hydroxynaphthalen-1-yl)-3-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)amino]prop-2-enamide |
| SMILES | CN1CCc2nc(N/C=C(/C#N)C(=O)Nc3cccc4c(O)cccc34)sc2C1 |
| InChI | InChI=1S/C21H19N5O2S/c1-26-9-8-17-19(12-26)29-21(25-17)23-11-13(10-22)20(28)24-16-6-2-5-15-14(16)4-3-7-18(15)27/h2-7,11,27H,8-9,12H2,1H3,(H,23,25)(H,24,28)/b13-11- |
| InChIKey | SUEWQZYXWRJMEZ-QBFSEMIESA-N |
| XLogP | 3.45 |
| TPSA | 101.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|