C21H44O5Si2 — CID 10884542
2-[(2S,3S,4S,5R,6R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methoxy-4-methyloxan-2-yl]acetaldehyde (PubChem CID 10884542) has the molecular formula C21H44O5Si2 and a molecular weight of 432.75 g/mol. Its IUPAC name is 2-[(2S,3S,4S,5R,6R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methoxy-4-methyloxan-2-yl]acetaldehyde.
| Compound Name | 2-[(2S,3S,4S,5R,6R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methoxy-4-methyloxan-2-yl]acetaldehyde |
|---|---|
| PubChem CID | 10884542 |
| Molecular Formula | C21H44O5Si2 |
| Molecular Weight | 432.75 g/mol |
| Exact Mass | 432.27 |
| IUPAC Name | 2-[(2S,3S,4S,5R,6R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methoxy-4-methyloxan-2-yl]acetaldehyde |
| SMILES | CO[C@@H]1O[C@@H](CC=O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H44O5Si2/c1-15-17(25-27(9,10)20(2,3)4)16(13-14-22)24-19(23-8)18(15)26-28(11,12)21(5,6)7/h14-19H,13H2,1-12H3/t15-,16-,17-,18+,19+/m0/s1 |
| InChIKey | YBEJRFWMVSZKPI-LTFXXXRZSA-N |
| XLogP | 5.36 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.75 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|