C18H36O5Si — CID 10498770
(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-4-[(2S,6S)-2,6-dimethoxyoxan-4-yl]-2-methylbutanal (PubChem CID 10498770) has the molecular formula C18H36O5Si and a molecular weight of 360.57 g/mol. Its IUPAC name is (2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-4-[(2S,6S)-2,6-dimethoxyoxan-4-yl]-2-methylbutanal.
| Compound Name | (2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-4-[(2S,6S)-2,6-dimethoxyoxan-4-yl]-2-methylbutanal |
|---|---|
| PubChem CID | 10498770 |
| Molecular Formula | C18H36O5Si |
| Molecular Weight | 360.57 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | (2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-4-[(2S,6S)-2,6-dimethoxyoxan-4-yl]-2-methylbutanal |
| SMILES | CO[C@@H]1CC(C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)C=O)C[C@@H](OC)O1 |
| InChI | InChI=1S/C18H36O5Si/c1-13(12-19)15(23-24(7,8)18(2,3)4)9-14-10-16(20-5)22-17(11-14)21-6/h12-17H,9-11H2,1-8H3/t13-,15-,16+,17+/m1/s1 |
| InChIKey | SFNMMSHNFYPVOW-SIXLDLHFSA-N |
| XLogP | 3.97 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.57 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|