C18H28ClO4P2Rh- — CID 10885700
(2S,5S)-1-[2-[(2S,5S)-2,5-dimethylphospholan-1-yl]phenyl]-2,5-dimethylphospholane;rhodium;perchlorate (PubChem CID 10885700) has the molecular formula C18H28ClO4P2Rh- and a molecular weight of 508.73 g/mol. Its IUPAC name is (2S,5S)-1-[2-[(2S,5S)-2,5-dimethylphospholan-1-yl]phenyl]-2,5-dimethylphospholane;rhodium;perchlorate.
| Compound Name | (2S,5S)-1-[2-[(2S,5S)-2,5-dimethylphospholan-1-yl]phenyl]-2,5-dimethylphospholane;rhodium;perchlorate |
|---|---|
| PubChem CID | 10885700 |
| Molecular Formula | C18H28ClO4P2Rh- |
| Molecular Weight | 508.73 g/mol |
| Exact Mass | 508.02 |
| IUPAC Name | (2S,5S)-1-[2-[(2S,5S)-2,5-dimethylphospholan-1-yl]phenyl]-2,5-dimethylphospholane;rhodium;perchlorate |
| SMILES | C[C@H]1CC[C@H](C)P1c1ccccc1P1[C@@H](C)CC[C@@H]1C.[O-][Cl+3]([O-])([O-])[O-].[Rh] |
| InChI | InChI=1S/C18H28P2.ClHO4.Rh/c1-13-9-10-14(2)19(13)17-7-5-6-8-18(17)20-15(3)11-12-16(20)4;2-1(3,4)5;/h5-8,13-16H,9-12H2,1-4H3;(H,2,3,4,5);/p-1/t13-,14-,15-,16-;;/m0../s1 |
| InChIKey | XETIRLUTHGMIOY-USVCXNFQSA-M |
| XLogP | 0.28 |
| TPSA | 92.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.73 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|