C22H9BF15N — CID 10886386
tris(2,3,4,5,6-pentafluorophenyl)-pyrrolidin-1-ium-1-ylboranuide (PubChem CID 10886386) has the molecular formula C22H9BF15N and a molecular weight of 583.10 g/mol. Its IUPAC name is tris(2,3,4,5,6-pentafluorophenyl)-pyrrolidin-1-ium-1-ylboranuide.
| Compound Name | tris(2,3,4,5,6-pentafluorophenyl)-pyrrolidin-1-ium-1-ylboranuide |
|---|---|
| PubChem CID | 10886386 |
| Molecular Formula | C22H9BF15N |
| Molecular Weight | 583.10 g/mol |
| Exact Mass | 583.06 |
| IUPAC Name | tris(2,3,4,5,6-pentafluorophenyl)-pyrrolidin-1-ium-1-ylboranuide |
| SMILES | Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)[NH+]2CCCC2)c(F)c1F |
| InChI | InChI=1S/C22H9BF15N/c24-8-5(9(25)15(31)20(36)14(8)30)23(39-3-1-2-4-39,6-10(26)16(32)21(37)17(33)11(6)27)7-12(28)18(34)22(38)19(35)13(7)29/h39H,1-4H2 |
| InChIKey | IEFLIDIJNBCMPK-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.10 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|