C14H26N2O3 — CID 108912721
1-(cyclohexylidenemethyl)-3-(2,2-diethoxyethyl)urea (PubChem CID 108912721) has the molecular formula C14H26N2O3 and a molecular weight of 270.37 g/mol. Its IUPAC name is 1-(cyclohexylidenemethyl)-3-(2,2-diethoxyethyl)urea.
| Compound Name | 1-(cyclohexylidenemethyl)-3-(2,2-diethoxyethyl)urea |
|---|---|
| PubChem CID | 108912721 |
| Molecular Formula | C14H26N2O3 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.19 |
| IUPAC Name | 1-(cyclohexylidenemethyl)-3-(2,2-diethoxyethyl)urea |
| SMILES | CCOC(CNC(=O)NC=C1CCCCC1)OCC |
| InChI | InChI=1S/C14H26N2O3/c1-3-18-13(19-4-2)11-16-14(17)15-10-12-8-6-5-7-9-12/h10,13H,3-9,11H2,1-2H3,(H2,15,16,17) |
| InChIKey | IRXZZJQONSNYQZ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|