2-(2,2-diethoxyethylcarbamoylamino)oxyacetic acid

C9H18N2O6 — CID 91667036

IUPAC2-(2,2-diethoxyethylcarbamoylamino)oxyacetic acid
SMILESCCOC(CNC(=O)NOCC(=O)O)OCC
InChIInChI=1S/C9H18N2O6/c1-3-15-8(16-4-2)5-10-9(14)11-17-6-7(12)13/h8H,3-6H2,1-2H3,(H,12,13)(H2,10,11,14)
InChIKeyBJAASSIPNAEONG-UHFFFAOYSA-N
MW250.25 g/mol
LogP-0.30
Rot. Bonds9

About 2-(2,2-diethoxyethylcarbamoylamino)oxyacetic acid

2-(2,2-diethoxyethylcarbamoylamino)oxyacetic acid (PubChem CID 91667036) has the molecular formula C9H18N2O6 and a molecular weight of 250.25 g/mol. Its IUPAC name is 2-(2,2-diethoxyethylcarbamoylamino)oxyacetic acid.

Molecular Properties

Compound Name2-(2,2-diethoxyethylcarbamoylamino)oxyacetic acid
PubChem CID91667036
Molecular FormulaC9H18N2O6
Molecular Weight250.25 g/mol
Exact Mass250.12
IUPAC Name2-(2,2-diethoxyethylcarbamoylamino)oxyacetic acid
SMILESCCOC(CNC(=O)NOCC(=O)O)OCC
InChIInChI=1S/C9H18N2O6/c1-3-15-8(16-4-2)5-10-9(14)11-17-6-7(12)13/h8H,3-6H2,1-2H3,(H,12,13)(H2,10,11,14)
InChIKeyBJAASSIPNAEONG-UHFFFAOYSA-N
XLogP-0.30
TPSA106.12 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds9
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500250.25
LogP ≤ 5-0.30
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 2-(2,2-diethoxyethylcarbamoylamino)oxyacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,2-diethoxyethylcarbamoylamino)oxyacetic acid?
The IUPAC name of 2-(2,2-diethoxyethylcarbamoylamino)oxyacetic acid (CID 91667036) is 2-(2,2-diethoxyethylcarbamoylamino)oxyacetic acid.
What is the SMILES notation for 2-(2,2-diethoxyethylcarbamoylamino)oxyacetic acid?
The canonical SMILES for 2-(2,2-diethoxyethylcarbamoylamino)oxyacetic acid is CCOC(CNC(=O)NOCC(=O)O)OCC.
What is the InChIKey of 2-(2,2-diethoxyethylcarbamoylamino)oxyacetic acid?
The InChIKey is BJAASSIPNAEONG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O6/c1-3-15-8(16-4-2)5-10-9(14)11-17-6-7(12)13/h8H,3-6H2,1-2H3,(H,12,13)(H2,10,11,14).
What are the key properties of 2-(2,2-diethoxyethylcarbamoylamino)oxyacetic acid?
2-(2,2-diethoxyethylcarbamoylamino)oxyacetic acid has a molecular weight of 250.25 g/mol, XLogP of -0.30, 9 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-diethoxyethylcarbamoylamino)oxyacetic acid is sourced from PubChem (CID 91667036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).