C9H18N2O6 — CID 91667036
2-(2,2-diethoxyethylcarbamoylamino)oxyacetic acid (PubChem CID 91667036) has the molecular formula C9H18N2O6 and a molecular weight of 250.25 g/mol. Its IUPAC name is 2-(2,2-diethoxyethylcarbamoylamino)oxyacetic acid.
| Compound Name | 2-(2,2-diethoxyethylcarbamoylamino)oxyacetic acid |
|---|---|
| PubChem CID | 91667036 |
| Molecular Formula | C9H18N2O6 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 2-(2,2-diethoxyethylcarbamoylamino)oxyacetic acid |
| SMILES | CCOC(CNC(=O)NOCC(=O)O)OCC |
| InChI | InChI=1S/C9H18N2O6/c1-3-15-8(16-4-2)5-10-9(14)11-17-6-7(12)13/h8H,3-6H2,1-2H3,(H,12,13)(H2,10,11,14) |
| InChIKey | BJAASSIPNAEONG-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 106.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|