C6H5Br2F5 — CID 10892917
1-(1,2-dibromopropyl)-1,2,2,3,3-pentafluorocyclopropane (PubChem CID 10892917) has the molecular formula C6H5Br2F5 and a molecular weight of 331.90 g/mol. Its IUPAC name is 1-(1,2-dibromopropyl)-1,2,2,3,3-pentafluorocyclopropane.
| Compound Name | 1-(1,2-dibromopropyl)-1,2,2,3,3-pentafluorocyclopropane |
|---|---|
| PubChem CID | 10892917 |
| Molecular Formula | C6H5Br2F5 |
| Molecular Weight | 331.90 g/mol |
| Exact Mass | 329.87 |
| IUPAC Name | 1-(1,2-dibromopropyl)-1,2,2,3,3-pentafluorocyclopropane |
| SMILES | CC(Br)C(Br)C1(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C6H5Br2F5/c1-2(7)3(8)4(9)5(10,11)6(4,12)13/h2-3H,1H3 |
| InChIKey | JVKFSAPFLNIISS-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.90 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|