C8H5F11O — CID 4541334
1-(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl)ethanol (PubChem CID 4541334) has the molecular formula C8H5F11O and a molecular weight of 326.11 g/mol. Its IUPAC name is 1-(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl)ethanol.
| Compound Name | 1-(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl)ethanol |
|---|---|
| PubChem CID | 4541334 |
| Molecular Formula | C8H5F11O |
| Molecular Weight | 326.11 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | 1-(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl)ethanol |
| SMILES | CC(O)C1(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C8H5F11O/c1-2(20)3(9)4(10,11)6(14,15)8(18,19)7(16,17)5(3,12)13/h2,20H,1H3 |
| InChIKey | SVQLLPOUSBWFHB-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.11 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|