C12H14F10 — CID 121401406
1,1,2,2,3,3,4,4,5,6-decafluoro-5,6-di(propan-2-yl)cyclohexane (PubChem CID 121401406) has the molecular formula C12H14F10 and a molecular weight of 348.22 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,6-decafluoro-5,6-di(propan-2-yl)cyclohexane.
| Compound Name | 1,1,2,2,3,3,4,4,5,6-decafluoro-5,6-di(propan-2-yl)cyclohexane |
|---|---|
| PubChem CID | 121401406 |
| Molecular Formula | C12H14F10 |
| Molecular Weight | 348.22 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,6-decafluoro-5,6-di(propan-2-yl)cyclohexane |
| SMILES | CC(C)C1(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)C(C)C |
| InChI | InChI=1S/C12H14F10/c1-5(2)7(13)8(14,6(3)4)10(17,18)12(21,22)11(19,20)9(7,15)16/h5-6H,1-4H3 |
| InChIKey | NTMLLXKDVZBLTH-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.22 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|