C21H30N2O4 — CID 108935740
N-[1-[(E)-3,4-dimethylpent-2-enoyl]piperidin-4-yl]-3,4-dimethoxybenzamide (PubChem CID 108935740) has the molecular formula C21H30N2O4 and a molecular weight of 374.48 g/mol. Its IUPAC name is N-[1-[(E)-3,4-dimethylpent-2-enoyl]piperidin-4-yl]-3,4-dimethoxybenzamide.
| Compound Name | N-[1-[(E)-3,4-dimethylpent-2-enoyl]piperidin-4-yl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 108935740 |
| Molecular Formula | C21H30N2O4 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | N-[1-[(E)-3,4-dimethylpent-2-enoyl]piperidin-4-yl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NC2CCN(C(=O)/C=C(\C)C(C)C)CC2)cc1OC |
| InChI | InChI=1S/C21H30N2O4/c1-14(2)15(3)12-20(24)23-10-8-17(9-11-23)22-21(25)16-6-7-18(26-4)19(13-16)27-5/h6-7,12-14,17H,8-11H2,1-5H3,(H,22,25)/b15-12+ |
| InChIKey | PCSZXMAXHVGEFY-NTCAYCPXSA-N |
| XLogP | 3.03 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|