C25H54O3Si2 — CID 10895785
tert-butyl-[(E,2S,3S,4S,8R)-3-methoxy-4,6,8-trimethyl-9-triethylsilyloxynon-5-en-2-yl]oxy-dimethylsilane (PubChem CID 10895785) has the molecular formula C25H54O3Si2 and a molecular weight of 458.88 g/mol. Its IUPAC name is tert-butyl-[(E,2S,3S,4S,8R)-3-methoxy-4,6,8-trimethyl-9-triethylsilyloxynon-5-en-2-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(E,2S,3S,4S,8R)-3-methoxy-4,6,8-trimethyl-9-triethylsilyloxynon-5-en-2-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 10895785 |
| Molecular Formula | C25H54O3Si2 |
| Molecular Weight | 458.88 g/mol |
| Exact Mass | 458.36 |
| IUPAC Name | tert-butyl-[(E,2S,3S,4S,8R)-3-methoxy-4,6,8-trimethyl-9-triethylsilyloxynon-5-en-2-yl]oxy-dimethylsilane |
| SMILES | CC[Si](CC)(CC)OC[C@H](C)C/C(C)=C/[C@H](C)[C@H](OC)[C@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H54O3Si2/c1-14-30(15-2,16-3)27-19-21(5)17-20(4)18-22(6)24(26-11)23(7)28-29(12,13)25(8,9)10/h18,21-24H,14-17,19H2,1-13H3/b20-18+/t21-,22+,23+,24+/m1/s1 |
| InChIKey | CABCKDPWMAHVJG-IBZZZAIASA-N |
| XLogP | 8.04 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.88 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|