C22H21BrO6 — CID 10895824
6-bromo-7-hydroxy-4-[4-[(2,4,6-trimethylphenyl)methoxy]-1,3-dioxolan-2-yl]chromen-2-one (PubChem CID 10895824) has the molecular formula C22H21BrO6 and a molecular weight of 461.31 g/mol. Its IUPAC name is 6-bromo-7-hydroxy-4-[4-[(2,4,6-trimethylphenyl)methoxy]-1,3-dioxolan-2-yl]chromen-2-one.
| Compound Name | 6-bromo-7-hydroxy-4-[4-[(2,4,6-trimethylphenyl)methoxy]-1,3-dioxolan-2-yl]chromen-2-one |
|---|---|
| PubChem CID | 10895824 |
| Molecular Formula | C22H21BrO6 |
| Molecular Weight | 461.31 g/mol |
| Exact Mass | 460.05 |
| IUPAC Name | 6-bromo-7-hydroxy-4-[4-[(2,4,6-trimethylphenyl)methoxy]-1,3-dioxolan-2-yl]chromen-2-one |
| SMILES | Cc1cc(C)c(COC2COC(c3cc(=O)oc4cc(O)c(Br)cc34)O2)c(C)c1 |
| InChI | InChI=1S/C22H21BrO6/c1-11-4-12(2)16(13(3)5-11)9-26-21-10-27-22(29-21)15-7-20(25)28-19-8-18(24)17(23)6-14(15)19/h4-8,21-22,24H,9-10H2,1-3H3 |
| InChIKey | SXCIRTDJZHJRBM-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 78.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.31 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|