C13H22N2O5S — CID 108959841
N-(1,1-dioxothiolan-3-yl)-2,2-dimethyl-3-morpholin-4-yl-3-oxopropanamide (PubChem CID 108959841) has the molecular formula C13H22N2O5S and a molecular weight of 318.40 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-2,2-dimethyl-3-morpholin-4-yl-3-oxopropanamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-2,2-dimethyl-3-morpholin-4-yl-3-oxopropanamide |
|---|---|
| PubChem CID | 108959841 |
| Molecular Formula | C13H22N2O5S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-2,2-dimethyl-3-morpholin-4-yl-3-oxopropanamide |
| SMILES | CC(C)(C(=O)NC1CCS(=O)(=O)C1)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C13H22N2O5S/c1-13(2,12(17)15-4-6-20-7-5-15)11(16)14-10-3-8-21(18,19)9-10/h10H,3-9H2,1-2H3,(H,14,16) |
| InChIKey | PPXYFEHSAXEVCC-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|