C15H25N3O5S — CID 108961203
3-(4-acetylpiperazin-1-yl)-N-(1,1-dioxothiolan-3-yl)-2,2-dimethyl-3-oxopropanamide (PubChem CID 108961203) has the molecular formula C15H25N3O5S and a molecular weight of 359.45 g/mol. Its IUPAC name is 3-(4-acetylpiperazin-1-yl)-N-(1,1-dioxothiolan-3-yl)-2,2-dimethyl-3-oxopropanamide.
| Compound Name | 3-(4-acetylpiperazin-1-yl)-N-(1,1-dioxothiolan-3-yl)-2,2-dimethyl-3-oxopropanamide |
|---|---|
| PubChem CID | 108961203 |
| Molecular Formula | C15H25N3O5S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 3-(4-acetylpiperazin-1-yl)-N-(1,1-dioxothiolan-3-yl)-2,2-dimethyl-3-oxopropanamide |
| SMILES | CC(=O)N1CCN(C(=O)C(C)(C)C(=O)NC2CCS(=O)(=O)C2)CC1 |
| InChI | InChI=1S/C15H25N3O5S/c1-11(19)17-5-7-18(8-6-17)14(21)15(2,3)13(20)16-12-4-9-24(22,23)10-12/h12H,4-10H2,1-3H3,(H,16,20) |
| InChIKey | ONMDMWIDFIANJO-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|