C30H42O5S — CID 10896551
(1'S,3'E,8'E,12'E,15'S)-6'-(benzenesulfonyl)-4',8',12',15'-tetramethylspiro[1,3-dioxolane-2,16'-bicyclo[13.3.0]octadeca-3,8,12-triene]-5'-ol (PubChem CID 10896551) has the molecular formula C30H42O5S and a molecular weight of 514.73 g/mol. Its IUPAC name is (1'S,3'E,8'E,12'E,15'S)-6'-(benzenesulfonyl)-4',8',12',15'-tetramethylspiro[1,3-dioxolane-2,16'-bicyclo[13.3.0]octadeca-3,8,12-triene]-5'-ol.
| Compound Name | (1'S,3'E,8'E,12'E,15'S)-6'-(benzenesulfonyl)-4',8',12',15'-tetramethylspiro[1,3-dioxolane-2,16'-bicyclo[13.3.0]octadeca-3,8,12-triene]-5'-ol |
|---|---|
| PubChem CID | 10896551 |
| Molecular Formula | C30H42O5S |
| Molecular Weight | 514.73 g/mol |
| Exact Mass | 514.28 |
| IUPAC Name | (1'S,3'E,8'E,12'E,15'S)-6'-(benzenesulfonyl)-4',8',12',15'-tetramethylspiro[1,3-dioxolane-2,16'-bicyclo[13.3.0]octadeca-3,8,12-triene]-5'-ol |
| SMILES | C/C1=C\C[C@@]2(C)[C@H](C/C=C(\C)C(O)C(S(=O)(=O)c3ccccc3)C/C(C)=C/CC1)CCC21OCCO1 |
| InChI | InChI=1S/C30H42O5S/c1-22-9-8-10-23(2)21-27(36(32,33)26-11-6-5-7-12-26)28(31)24(3)13-14-25-16-18-30(34-19-20-35-30)29(25,4)17-15-22/h5-7,10-13,15,25,27-28,31H,8-9,14,16-21H2,1-4H3/b22-15+,23-10+,24-13+/t25-,27?,28?,29+/m1/s1 |
| InChIKey | GDJDMLMERCQCRZ-VFQXAARTSA-N |
| XLogP | 6.15 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.73 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|