C22H30O5S — CID 139637466
(2R,3S,3aS,6aS)-6-(benzenesulfonylmethyl)-3-[(E,3S)-5-ethoxy-3-hydroxypent-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol (PubChem CID 139637466) has the molecular formula C22H30O5S and a molecular weight of 406.54 g/mol. Its IUPAC name is (2R,3S,3aS,6aS)-6-(benzenesulfonylmethyl)-3-[(E,3S)-5-ethoxy-3-hydroxypent-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol.
| Compound Name | (2R,3S,3aS,6aS)-6-(benzenesulfonylmethyl)-3-[(E,3S)-5-ethoxy-3-hydroxypent-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
|---|---|
| PubChem CID | 139637466 |
| Molecular Formula | C22H30O5S |
| Molecular Weight | 406.54 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | (2R,3S,3aS,6aS)-6-(benzenesulfonylmethyl)-3-[(E,3S)-5-ethoxy-3-hydroxypent-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
| SMILES | CCOCC[C@H](O)/C=C/[C@H]1[C@H]2CC=C(CS(=O)(=O)c3ccccc3)[C@H]2C[C@H]1O |
| InChI | InChI=1S/C22H30O5S/c1-2-27-13-12-17(23)9-11-20-19-10-8-16(21(19)14-22(20)24)15-28(25,26)18-6-4-3-5-7-18/h3-9,11,17,19-24H,2,10,12-15H2,1H3/b11-9+/t17-,19-,20+,21-,22-/m1/s1 |
| InChIKey | IFFFQWQHSHHPKO-NFMRHVQXSA-N |
| XLogP | 2.75 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.54 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|