C30H46O5SSi — CID 10896894
tert-butyl-dimethyl-[(2R)-1-[(2S,3R)-2-(4-methylphenyl)sulfonyl-3-pentyloxiran-2-yl]-3-phenylmethoxypropan-2-yl]oxysilane (PubChem CID 10896894) has the molecular formula C30H46O5SSi and a molecular weight of 546.85 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(2R)-1-[(2S,3R)-2-(4-methylphenyl)sulfonyl-3-pentyloxiran-2-yl]-3-phenylmethoxypropan-2-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(2R)-1-[(2S,3R)-2-(4-methylphenyl)sulfonyl-3-pentyloxiran-2-yl]-3-phenylmethoxypropan-2-yl]oxysilane |
|---|---|
| PubChem CID | 10896894 |
| Molecular Formula | C30H46O5SSi |
| Molecular Weight | 546.85 g/mol |
| Exact Mass | 546.28 |
| IUPAC Name | tert-butyl-dimethyl-[(2R)-1-[(2S,3R)-2-(4-methylphenyl)sulfonyl-3-pentyloxiran-2-yl]-3-phenylmethoxypropan-2-yl]oxysilane |
| SMILES | CCCCC[C@H]1O[C@@]1(C[C@H](COCc1ccccc1)O[Si](C)(C)C(C)(C)C)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C30H46O5SSi/c1-8-9-11-16-28-30(34-28,36(31,32)27-19-17-24(2)18-20-27)21-26(35-37(6,7)29(3,4)5)23-33-22-25-14-12-10-13-15-25/h10,12-15,17-20,26,28H,8-9,11,16,21-23H2,1-7H3/t26-,28-,30+/m1/s1 |
| InChIKey | CJQOCCLUSRYXAR-GFKSZRKTSA-N |
| XLogP | 7.44 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.85 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|