C19H19NOS — CID 10913902
3-butyl-2,5-diphenyl-1,3-thiazol-3-ium-4-olate (PubChem CID 10913902) has the molecular formula C19H19NOS and a molecular weight of 309.43 g/mol. Its IUPAC name is 3-butyl-2,5-diphenyl-1,3-thiazol-3-ium-4-olate.
| Compound Name | 3-butyl-2,5-diphenyl-1,3-thiazol-3-ium-4-olate |
|---|---|
| PubChem CID | 10913902 |
| Molecular Formula | C19H19NOS |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | 3-butyl-2,5-diphenyl-1,3-thiazol-3-ium-4-olate |
| SMILES | CCCC[n+]1c(-c2ccccc2)sc(-c2ccccc2)c1[O-] |
| InChI | InChI=1S/C19H19NOS/c1-2-3-14-20-18(21)17(15-10-6-4-7-11-15)22-19(20)16-12-8-5-9-13-16/h4-13H,2-3,14H2,1H3 |
| InChIKey | KKVYIYJMMKISSE-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 26.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|