C37H50N2O10 — CID 10919506
tert-butyl N-(33-amino-2,13,19,30-tetraoxo-3,12,20,29-tetraoxatricyclo[29.3.1.114,18]hexatriaconta-1(35),14(36),15,17,31,33-hexaen-16-yl)carbamate (PubChem CID 10919506) has the molecular formula C37H50N2O10 and a molecular weight of 682.81 g/mol. Its IUPAC name is tert-butyl N-(33-amino-2,13,19,30-tetraoxo-3,12,20,29-tetraoxatricyclo[29.3.1.114,18]hexatriaconta-1(35),14(36),15,17,31,33-hexaen-16-yl)carbamate.
| Compound Name | tert-butyl N-(33-amino-2,13,19,30-tetraoxo-3,12,20,29-tetraoxatricyclo[29.3.1.114,18]hexatriaconta-1(35),14(36),15,17,31,33-hexaen-16-yl)carbamate |
|---|---|
| PubChem CID | 10919506 |
| Molecular Formula | C37H50N2O10 |
| Molecular Weight | 682.81 g/mol |
| Exact Mass | 682.35 |
| IUPAC Name | tert-butyl N-(33-amino-2,13,19,30-tetraoxo-3,12,20,29-tetraoxatricyclo[29.3.1.114,18]hexatriaconta-1(35),14(36),15,17,31,33-hexaen-16-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cc2cc(c1)C(=O)OCCCCCCCCOC(=O)c1cc(N)cc(c1)C(=O)OCCCCCCCCOC2=O |
| InChI | InChI=1S/C37H50N2O10/c1-37(2,3)49-36(44)39-31-24-28-21-29(25-31)35(43)48-19-15-11-7-5-9-13-17-46-33(41)27-20-26(22-30(38)23-27)32(40)45-16-12-8-4-6-10-14-18-47-34(28)42/h20-25H,4-19,38H2,1-3H3,(H,39,44) |
| InChIKey | VTDHDAPUIIVTCN-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 169.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.81 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|