C16H16O4 — CID 10923675
[(1S,5S)-3-ethynyl-5-hydroxy-4-methylcyclohex-3-en-1-yl] phenyl carbonate (PubChem CID 10923675) has the molecular formula C16H16O4 and a molecular weight of 272.30 g/mol. Its IUPAC name is [(1S,5S)-3-ethynyl-5-hydroxy-4-methylcyclohex-3-en-1-yl] phenyl carbonate.
| Compound Name | [(1S,5S)-3-ethynyl-5-hydroxy-4-methylcyclohex-3-en-1-yl] phenyl carbonate |
|---|---|
| PubChem CID | 10923675 |
| Molecular Formula | C16H16O4 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | [(1S,5S)-3-ethynyl-5-hydroxy-4-methylcyclohex-3-en-1-yl] phenyl carbonate |
| SMILES | C#CC1=C(C)[C@@H](O)C[C@@H](OC(=O)Oc2ccccc2)C1 |
| InChI | InChI=1S/C16H16O4/c1-3-12-9-14(10-15(17)11(12)2)20-16(18)19-13-7-5-4-6-8-13/h1,4-8,14-15,17H,9-10H2,2H3/t14-,15-/m0/s1 |
| InChIKey | ZPNAKKYQLYYDPJ-GJZGRUSLSA-N |
| XLogP | 2.67 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|